C20H22N2O3 — CID 69097215
6-[(2-butan-2-yl-6-methoxy-1H-indol-3-yl)methyl]pyridine-2-carboxylic acid (PubChem CID 69097215) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-[(2-butan-2-yl-6-methoxy-1H-indol-3-yl)methyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2-butan-2-yl-6-methoxy-1H-indol-3-yl)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 69097215 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 6-[(2-butan-2-yl-6-methoxy-1H-indol-3-yl)methyl]pyridine-2-carboxylic acid |
| SMILES | CCC(C)c1[nH]c2cc(OC)ccc2c1Cc1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-12(2)19-16(10-13-6-5-7-17(21-13)20(23)24)15-9-8-14(25-3)11-18(15)22-19/h5-9,11-12,22H,4,10H2,1-3H3,(H,23,24) |
| InChIKey | HXKLSSUKHUTAKU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |