C18H28O2 — CID 69097308
1-[(3-butylphenoxy)methyl]cycloheptan-1-ol (PubChem CID 69097308) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-[(3-butylphenoxy)methyl]cycloheptan-1-ol.
| Compound Name | 1-[(3-butylphenoxy)methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 69097308 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-[(3-butylphenoxy)methyl]cycloheptan-1-ol |
| SMILES | CCCCc1cccc(OCC2(O)CCCCCC2)c1 |
| InChI | InChI=1S/C18H28O2/c1-2-3-9-16-10-8-11-17(14-16)20-15-18(19)12-6-4-5-7-13-18/h8,10-11,14,19H,2-7,9,12-13,15H2,1H3 |
| InChIKey | MDSYBKICZOPULC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |