C21H28O2 — CID 69097411
1-butyl-3-(4-phenylmethoxybutoxy)benzene (PubChem CID 69097411) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-butyl-3-(4-phenylmethoxybutoxy)benzene.
| Compound Name | 1-butyl-3-(4-phenylmethoxybutoxy)benzene |
|---|---|
| PubChem CID | 69097411 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-butyl-3-(4-phenylmethoxybutoxy)benzene |
| SMILES | CCCCc1cccc(OCCCCOCc2ccccc2)c1 |
| InChI | InChI=1S/C21H28O2/c1-2-3-10-19-13-9-14-21(17-19)23-16-8-7-15-22-18-20-11-5-4-6-12-20/h4-6,9,11-14,17H,2-3,7-8,10,15-16,18H2,1H3 |
| InChIKey | IHTXFWINZJTJGT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|