About 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one
1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one (PubChem CID 69097594) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one |
| PubChem CID | 69097594 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1cnc2cccnn12 |
| InChI | InChI=1S/C10H11N3O/c1-7(2)10(14)8-6-11-9-4-3-5-12-13(8)9/h3-7H,1-2H3 |
| InChIKey | LLSWVCVYHCUPHC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one?
The IUPAC name of 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one (CID 69097594) is 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one.
What is the SMILES notation for 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one?
The canonical SMILES for 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one is CC(C)C(=O)c1cnc2cccnn12.
What is the InChIKey of 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one?
The InChIKey is LLSWVCVYHCUPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-7(2)10(14)8-6-11-9-4-3-5-12-13(8)9/h3-7H,1-2H3.
What are the key properties of 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one?
1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one has a molecular weight of 189.22 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[1,2-b]pyridazin-3-yl-2-methylpropan-1-one is sourced from PubChem (CID 69097594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).