C15H22O3S — CID 69097885
5-ethylsulfonyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran (PubChem CID 69097885) has the molecular formula C15H22O3S and a molecular weight of 282.41 g/mol. Its IUPAC name is 5-ethylsulfonyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran.
| Compound Name | 5-ethylsulfonyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 69097885 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 5-ethylsulfonyl-2,2,4,6,7-pentamethyl-3H-1-benzofuran |
| SMILES | CCS(=O)(=O)c1c(C)c(C)c2c(c1C)CC(C)(C)O2 |
| InChI | InChI=1S/C15H22O3S/c1-7-19(16,17)14-10(3)9(2)13-12(11(14)4)8-15(5,6)18-13/h7-8H2,1-6H3 |
| InChIKey | YMGFGQSNXWSXOO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |