C50H42OSi2 — CID 69098117
[4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)-8-trimethylsilyldibenzofuran-2-yl]-trimethylsilane (PubChem CID 69098117) has the molecular formula C50H42OSi2 and a molecular weight of 715.06 g/mol. Its IUPAC name is [4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)-8-trimethylsilyldibenzofuran-2-yl]-trimethylsilane.
| Compound Name | [4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)-8-trimethylsilyldibenzofuran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 69098117 |
| Molecular Formula | C50H42OSi2 |
| Molecular Weight | 715.06 g/mol |
| Exact Mass | 714.28 |
| IUPAC Name | [4-(7,12-diphenylbenzo[k]fluoranthen-3-yl)-8-trimethylsilyldibenzofuran-2-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc2oc3c(-c4ccc5c6c(cccc46)-c4c-5c(-c5ccccc5)c5ccccc5c4-c4ccccc4)cc([Si](C)(C)C)cc3c2c1 |
| InChI | InChI=1S/C50H42OSi2/c1-52(2,3)33-24-27-44-41(28-33)43-30-34(53(4,5)6)29-42(50(43)51-44)35-25-26-40-47-36(35)22-15-23-39(47)48-45(31-16-9-7-10-17-31)37-20-13-14-21-38(37)46(49(40)48)32-18-11-8-12-19-32/h7-30H,1-6H3 |
| InChIKey | KPYBZNRHFNVZRY-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.06 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|