About piperidine-2,6-dione;prop-2-enoic acid
piperidine-2,6-dione;prop-2-enoic acid (PubChem CID 69098530) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is piperidine-2,6-dione;prop-2-enoic acid.
Molecular Properties
| Compound Name | piperidine-2,6-dione;prop-2-enoic acid |
| PubChem CID | 69098530 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | piperidine-2,6-dione;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C5H7NO2.C3H4O2/c7-4-2-1-3-5(8)6-4;1-2-3(4)5/h1-3H2,(H,6,7,8);2H,1H2,(H,4,5) |
| InChIKey | UYRCZVWCEYWONG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze piperidine-2,6-dione;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-2,6-dione;prop-2-enoic acid?
The IUPAC name of piperidine-2,6-dione;prop-2-enoic acid (CID 69098530) is piperidine-2,6-dione;prop-2-enoic acid.
What is the SMILES notation for piperidine-2,6-dione;prop-2-enoic acid?
The canonical SMILES for piperidine-2,6-dione;prop-2-enoic acid is C=CC(=O)O.O=C1CCCC(=O)N1.
What is the InChIKey of piperidine-2,6-dione;prop-2-enoic acid?
The InChIKey is UYRCZVWCEYWONG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.C3H4O2/c7-4-2-1-3-5(8)6-4;1-2-3(4)5/h1-3H2,(H,6,7,8);2H,1H2,(H,4,5).
What are the key properties of piperidine-2,6-dione;prop-2-enoic acid?
piperidine-2,6-dione;prop-2-enoic acid has a molecular weight of 185.18 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-2,6-dione;prop-2-enoic acid is sourced from PubChem (CID 69098530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).