About [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol
[(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol (PubChem CID 69098962) has the molecular formula C12H15F3N2O
and a molecular weight of 260.26 g/mol. Its IUPAC name is [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol |
| PubChem CID | 69098962 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol |
| SMILES | OC[C@H]1CN(Cc2cc(F)cc(F)c2F)CCN1 |
| InChI | InChI=1S/C12H15F3N2O/c13-9-3-8(12(15)11(14)4-9)5-17-2-1-16-10(6-17)7-18/h3-4,10,16,18H,1-2,5-7H2/t10-/m1/s1 |
| InChIKey | DAPMQQMQASYEMZ-SNVBAGLBSA-N |
| XLogP | 0.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol?
The IUPAC name of [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol (CID 69098962) is [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol.
What is the SMILES notation for [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol?
The canonical SMILES for [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol is OC[C@H]1CN(Cc2cc(F)cc(F)c2F)CCN1.
What is the InChIKey of [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol?
The InChIKey is DAPMQQMQASYEMZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H15F3N2O/c13-9-3-8(12(15)11(14)4-9)5-17-2-1-16-10(6-17)7-18/h3-4,10,16,18H,1-2,5-7H2/t10-/m1/s1.
What are the key properties of [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol?
[(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol has a molecular weight of 260.26 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-[(2,3,5-trifluorophenyl)methyl]piperazin-2-yl]methanol is sourced from PubChem (CID 69098962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).