About (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine
(2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine (PubChem CID 69099483) has the molecular formula C12H15F3N2
and a molecular weight of 244.26 g/mol. Its IUPAC name is (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine.
Molecular Properties
| Compound Name | (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine |
| PubChem CID | 69099483 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine |
| SMILES | C[C@@H]1CNCCN1Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C12H15F3N2/c1-8-6-16-2-3-17(8)7-9-4-10(13)5-11(14)12(9)15/h4-5,8,16H,2-3,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | MRDBAUMAHBIYAO-MRVPVSSYSA-N |
| XLogP | 1.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine?
The IUPAC name of (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine (CID 69099483) is (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine.
What is the SMILES notation for (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine?
The canonical SMILES for (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine is C[C@@H]1CNCCN1Cc1cc(F)cc(F)c1F.
What is the InChIKey of (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine?
The InChIKey is MRDBAUMAHBIYAO-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H15F3N2/c1-8-6-16-2-3-17(8)7-9-4-10(13)5-11(14)12(9)15/h4-5,8,16H,2-3,6-7H2,1H3/t8-/m1/s1.
What are the key properties of (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine?
(2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine has a molecular weight of 244.26 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-1-[(2,3,5-trifluorophenyl)methyl]piperazine is sourced from PubChem (CID 69099483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).