About 2-(4-ethenylphenyl)-1,3-dioxane
2-(4-ethenylphenyl)-1,3-dioxane (PubChem CID 69099631) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)-1,3-dioxane |
| PubChem CID | 69099631 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(4-ethenylphenyl)-1,3-dioxane |
| SMILES | C=Cc1ccc(C2OCCCO2)cc1 |
| InChI | InChI=1S/C12H14O2/c1-2-10-4-6-11(7-5-10)12-13-8-3-9-14-12/h2,4-7,12H,1,3,8-9H2 |
| InChIKey | LPLAARHFTKKELA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-ethenylphenyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)-1,3-dioxane?
The IUPAC name of 2-(4-ethenylphenyl)-1,3-dioxane (CID 69099631) is 2-(4-ethenylphenyl)-1,3-dioxane.
What is the SMILES notation for 2-(4-ethenylphenyl)-1,3-dioxane?
The canonical SMILES for 2-(4-ethenylphenyl)-1,3-dioxane is C=Cc1ccc(C2OCCCO2)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)-1,3-dioxane?
The InChIKey is LPLAARHFTKKELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-10-4-6-11(7-5-10)12-13-8-3-9-14-12/h2,4-7,12H,1,3,8-9H2.
What are the key properties of 2-(4-ethenylphenyl)-1,3-dioxane?
2-(4-ethenylphenyl)-1,3-dioxane has a molecular weight of 190.24 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)-1,3-dioxane is sourced from PubChem (CID 69099631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).