C30H47N3O3SSi — CID 69100304
4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 69100304) has the molecular formula C30H47N3O3SSi and a molecular weight of 557.88 g/mol. Its IUPAC name is 4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 69100304 |
| Molecular Formula | C30H47N3O3SSi |
| Molecular Weight | 557.88 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | 4-[[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-[(2R,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | C=CCN1C[C@@H](C)N(C(c2ccc(S(=O)(=O)N(C)C)cc2)c2cccc(O[Si](C)(C)C(C)(C)C)c2)C[C@H]1C |
| InChI | InChI=1S/C30H47N3O3SSi/c1-11-19-32-21-24(3)33(22-23(32)2)29(25-15-17-28(18-16-25)37(34,35)31(7)8)26-13-12-14-27(20-26)36-38(9,10)30(4,5)6/h11-18,20,23-24,29H,1,19,21-22H2,2-10H3/t23-,24-,29?/m1/s1 |
| InChIKey | MBTNADILOKJYBI-MAUFCEJDSA-N |
| XLogP | 5.99 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|