C37H41F3N4O3 — CID 69100775
(2R)-N-(piperidin-4-ylmethyl)-1-[(2S)-1-[3,3,3-tris(4-fluorophenyl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide (PubChem CID 69100775) has the molecular formula C37H41F3N4O3 and a molecular weight of 646.75 g/mol. Its IUPAC name is (2R)-N-(piperidin-4-ylmethyl)-1-[(2S)-1-[3,3,3-tris(4-fluorophenyl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(piperidin-4-ylmethyl)-1-[(2S)-1-[3,3,3-tris(4-fluorophenyl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 69100775 |
| Molecular Formula | C37H41F3N4O3 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | (2R)-N-(piperidin-4-ylmethyl)-1-[(2S)-1-[3,3,3-tris(4-fluorophenyl)propanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CCNCC1)[C@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CC(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C37H41F3N4O3/c38-29-11-5-26(6-12-29)37(27-7-13-30(39)14-8-27,28-9-15-31(40)16-10-28)23-34(45)43-21-2-4-33(43)36(47)44-22-1-3-32(44)35(46)42-24-25-17-19-41-20-18-25/h5-16,25,32-33,41H,1-4,17-24H2,(H,42,46)/t32-,33+/m1/s1 |
| InChIKey | QSGLZYUYKLMPQZ-SAIUNTKASA-N |
| XLogP | 4.93 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|