C28H54N2O10Si — CID 69100995
2-hydroxyethyl N-[[2-hydroxyethoxycarbonyl-[3-(2,4,4,6-tetramethyl-1,3-dioxan-2-yl)propyl]amino]methyl]-N-[3-(2,4,4,6-tetramethyl-1,3,2-dioxasilinan-2-yl)propyl]carbamate (PubChem CID 69100995) has the molecular formula C28H54N2O10Si and a molecular weight of 606.83 g/mol. Its IUPAC name is 2-hydroxyethyl N-[[2-hydroxyethoxycarbonyl-[3-(2,4,4,6-tetramethyl-1,3-dioxan-2-yl)propyl]amino]methyl]-N-[3-(2,4,4,6-tetramethyl-1,3,2-dioxasilinan-2-yl)propyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[[2-hydroxyethoxycarbonyl-[3-(2,4,4,6-tetramethyl-1,3-dioxan-2-yl)propyl]amino]methyl]-N-[3-(2,4,4,6-tetramethyl-1,3,2-dioxasilinan-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 69100995 |
| Molecular Formula | C28H54N2O10Si |
| Molecular Weight | 606.83 g/mol |
| Exact Mass | 606.35 |
| IUPAC Name | 2-hydroxyethyl N-[[2-hydroxyethoxycarbonyl-[3-(2,4,4,6-tetramethyl-1,3-dioxan-2-yl)propyl]amino]methyl]-N-[3-(2,4,4,6-tetramethyl-1,3,2-dioxasilinan-2-yl)propyl]carbamate |
| SMILES | CC1CC(C)(C)OC(C)(CCCN(CN(CCC[Si]2(C)OC(C)CC(C)(C)O2)C(=O)OCCO)C(=O)OCCO)O1 |
| InChI | InChI=1S/C28H54N2O10Si/c1-22-19-26(3,4)39-28(7,37-22)11-9-12-29(24(33)35-16-14-31)21-30(25(34)36-17-15-32)13-10-18-41(8)38-23(2)20-27(5,6)40-41/h22-23,31-32H,9-21H2,1-8H3 |
| InChIKey | KLLJCPRNRHUYSE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|