C18H15BrFN5O2 — CID 69101382
2-(4-bromo-2-fluorophenyl)-7-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)quinazoline-4,6-diamine (PubChem CID 69101382) has the molecular formula C18H15BrFN5O2 and a molecular weight of 432.25 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-7-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)quinazoline-4,6-diamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-7-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69101382 |
| Molecular Formula | C18H15BrFN5O2 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-7-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)quinazoline-4,6-diamine |
| SMILES | Nc1cc2c(N)nc(-c3ccc(Br)cc3F)nc2cc1OCC1=NCCO1 |
| InChI | InChI=1S/C18H15BrFN5O2/c19-9-1-2-10(12(20)5-9)18-24-14-7-15(27-8-16-23-3-4-26-16)13(21)6-11(14)17(22)25-18/h1-2,5-7H,3-4,8,21H2,(H2,22,24,25) |
| InChIKey | XMVUAWLJDSSPHB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|