C35H44N4O3 — CID 69101431
N-[2-oxo-2-[[3-oxo-3-[[(3R)-1-propylpiperidin-3-yl]methylamino]propyl]amino]ethyl]-3,3,3-triphenylpropanamide (PubChem CID 69101431) has the molecular formula C35H44N4O3 and a molecular weight of 568.76 g/mol. Its IUPAC name is N-[2-oxo-2-[[3-oxo-3-[[(3R)-1-propylpiperidin-3-yl]methylamino]propyl]amino]ethyl]-3,3,3-triphenylpropanamide.
| Compound Name | N-[2-oxo-2-[[3-oxo-3-[[(3R)-1-propylpiperidin-3-yl]methylamino]propyl]amino]ethyl]-3,3,3-triphenylpropanamide |
|---|---|
| PubChem CID | 69101431 |
| Molecular Formula | C35H44N4O3 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.34 |
| IUPAC Name | N-[2-oxo-2-[[3-oxo-3-[[(3R)-1-propylpiperidin-3-yl]methylamino]propyl]amino]ethyl]-3,3,3-triphenylpropanamide |
| SMILES | CCCN1CCC[C@H](CNC(=O)CCNC(=O)CNC(=O)CC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C35H44N4O3/c1-2-22-39-23-12-13-28(27-39)25-37-32(40)20-21-36-34(42)26-38-33(41)24-35(29-14-6-3-7-15-29,30-16-8-4-9-17-30)31-18-10-5-11-19-31/h3-11,14-19,28H,2,12-13,20-27H2,1H3,(H,36,42)(H,37,40)(H,38,41)/t28-/m1/s1 |
| InChIKey | OPBZTQJWZUIBCT-MUUNZHRXSA-N |
| XLogP | 4.27 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|