About 8-anilino-1,6-naphthyridine-2-carboxylic acid
8-anilino-1,6-naphthyridine-2-carboxylic acid (PubChem CID 69101575) has the molecular formula C15H11N3O2
and a molecular weight of 265.27 g/mol. Its IUPAC name is 8-anilino-1,6-naphthyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-anilino-1,6-naphthyridine-2-carboxylic acid |
| PubChem CID | 69101575 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 8-anilino-1,6-naphthyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cncc(Nc3ccccc3)c2n1 |
| InChI | InChI=1S/C15H11N3O2/c19-15(20)12-7-6-10-8-16-9-13(14(10)18-12)17-11-4-2-1-3-5-11/h1-9,17H,(H,19,20) |
| InChIKey | DJDMQMKLDYUOGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-anilino-1,6-naphthyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-anilino-1,6-naphthyridine-2-carboxylic acid?
The IUPAC name of 8-anilino-1,6-naphthyridine-2-carboxylic acid (CID 69101575) is 8-anilino-1,6-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 8-anilino-1,6-naphthyridine-2-carboxylic acid?
The canonical SMILES for 8-anilino-1,6-naphthyridine-2-carboxylic acid is O=C(O)c1ccc2cncc(Nc3ccccc3)c2n1.
What is the InChIKey of 8-anilino-1,6-naphthyridine-2-carboxylic acid?
The InChIKey is DJDMQMKLDYUOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2/c19-15(20)12-7-6-10-8-16-9-13(14(10)18-12)17-11-4-2-1-3-5-11/h1-9,17H,(H,19,20).
What are the key properties of 8-anilino-1,6-naphthyridine-2-carboxylic acid?
8-anilino-1,6-naphthyridine-2-carboxylic acid has a molecular weight of 265.27 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-anilino-1,6-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 69101575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).