C23H21NO4 — CID 69102039
bis(2-phenylethyl) pyridine-2,4-dicarboxylate (PubChem CID 69102039) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is bis(2-phenylethyl) pyridine-2,4-dicarboxylate.
| Compound Name | bis(2-phenylethyl) pyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 69102039 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | bis(2-phenylethyl) pyridine-2,4-dicarboxylate |
| SMILES | O=C(OCCc1ccccc1)c1ccnc(C(=O)OCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO4/c25-22(27-15-12-18-7-3-1-4-8-18)20-11-14-24-21(17-20)23(26)28-16-13-19-9-5-2-6-10-19/h1-11,14,17H,12-13,15-16H2 |
| InChIKey | WGUKPYYKOZNSGA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |