About 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one
5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one (PubChem CID 69103237) has the molecular formula C18H16F2N4O
and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one |
| PubChem CID | 69103237 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one |
| SMILES | CC(C)n1cc(-c2ncc(N)nc2-c2ccc(F)cc2F)ccc1=O |
| InChI | InChI=1S/C18H16F2N4O/c1-10(2)24-9-11(3-6-16(24)25)17-18(23-15(21)8-22-17)13-5-4-12(19)7-14(13)20/h3-10H,1-2H3,(H2,21,23) |
| InChIKey | FHUXBPOKUPEXFV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one?
The IUPAC name of 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one (CID 69103237) is 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one.
What is the SMILES notation for 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one?
The canonical SMILES for 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one is CC(C)n1cc(-c2ncc(N)nc2-c2ccc(F)cc2F)ccc1=O.
What is the InChIKey of 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one?
The InChIKey is FHUXBPOKUPEXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N4O/c1-10(2)24-9-11(3-6-16(24)25)17-18(23-15(21)8-22-17)13-5-4-12(19)7-14(13)20/h3-10H,1-2H3,(H2,21,23).
What are the key properties of 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one?
5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one has a molecular weight of 342.35 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-amino-3-(2,4-difluorophenyl)pyrazin-2-yl]-1-propan-2-ylpyridin-2-one is sourced from PubChem (CID 69103237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).