About 2-tert-butylporphyrin
2-tert-butylporphyrin (PubChem CID 69103838) has the molecular formula C24H20N4
and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-tert-butylporphyrin.
Molecular Properties
| Compound Name | 2-tert-butylporphyrin |
| PubChem CID | 69103838 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2-tert-butylporphyrin |
| SMILES | CC(C)(C)C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C24H20N4/c1-24(2,3)22-13-21-12-19-7-6-17(26-19)10-15-4-5-16(25-15)11-18-8-9-20(27-18)14-23(22)28-21/h4-14H,1-3H3/b15-10-,16-11-,17-10-,18-11-,19-12-,20-14-,21-12-,23-14- |
| InChIKey | JFCHZQLMWNWTNE-VCLXWBCXSA-N |
| XLogP | 5.00 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylporphyrin?
The IUPAC name of 2-tert-butylporphyrin (CID 69103838) is 2-tert-butylporphyrin.
What is the SMILES notation for 2-tert-butylporphyrin?
The canonical SMILES for 2-tert-butylporphyrin is CC(C)(C)C1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1.
What is the InChIKey of 2-tert-butylporphyrin?
The InChIKey is JFCHZQLMWNWTNE-VCLXWBCXSA-N. The full InChI is InChI=1S/C24H20N4/c1-24(2,3)22-13-21-12-19-7-6-17(26-19)10-15-4-5-16(25-15)11-18-8-9-20(27-18)14-23(22)28-21/h4-14H,1-3H3/b15-10-,16-11-,17-10-,18-11-,19-12-,20-14-,21-12-,23-14-.
What are the key properties of 2-tert-butylporphyrin?
2-tert-butylporphyrin has a molecular weight of 364.45 g/mol, XLogP of 5.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylporphyrin is sourced from PubChem (CID 69103838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).