About (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid
(1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 69104308) has the molecular formula C9H11NO5
and a molecular weight of 213.19 g/mol. Its IUPAC name is (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 69104308 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)CNC1=CC[C@@](O)(C(=O)O)C=C1 |
| InChI | InChI=1S/C9H11NO5/c11-7(12)5-10-6-1-3-9(15,4-2-6)8(13)14/h1-3,10,15H,4-5H2,(H,11,12)(H,13,14)/t9-/m1/s1 |
| InChIKey | MGLHQYVDGYTFEO-SECBINFHSA-N |
| XLogP | -0.68 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid (CID 69104308) is (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid is O=C(O)CNC1=CC[C@@](O)(C(=O)O)C=C1.
What is the InChIKey of (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is MGLHQYVDGYTFEO-SECBINFHSA-N. The full InChI is InChI=1S/C9H11NO5/c11-7(12)5-10-6-1-3-9(15,4-2-6)8(13)14/h1-3,10,15H,4-5H2,(H,11,12)(H,13,14)/t9-/m1/s1.
What are the key properties of (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid?
(1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 213.19 g/mol, XLogP of -0.68, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-(carboxymethylamino)-1-hydroxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 69104308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).