C22H29ClN4O2 — CID 69104482
1-(3-aminobutyl)-N-[(3-chlorophenyl)methyl]-N-(4-nitrophenyl)piperidin-4-amine (PubChem CID 69104482) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-(3-aminobutyl)-N-[(3-chlorophenyl)methyl]-N-(4-nitrophenyl)piperidin-4-amine.
| Compound Name | 1-(3-aminobutyl)-N-[(3-chlorophenyl)methyl]-N-(4-nitrophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 69104482 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-(3-aminobutyl)-N-[(3-chlorophenyl)methyl]-N-(4-nitrophenyl)piperidin-4-amine |
| SMILES | CC(N)CCN1CCC(N(Cc2cccc(Cl)c2)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H29ClN4O2/c1-17(24)9-12-25-13-10-21(11-14-25)26(16-18-3-2-4-19(23)15-18)20-5-7-22(8-6-20)27(28)29/h2-8,15,17,21H,9-14,16,24H2,1H3 |
| InChIKey | TZVFRLPWHSKRFM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|