C18H25N3O5 — CID 69104681
4-[[4-amino-4-methyl-3-[(2-methylprop-2-enoylamino)methyl]pentanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 69104681) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-[[4-amino-4-methyl-3-[(2-methylprop-2-enoylamino)methyl]pentanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[4-amino-4-methyl-3-[(2-methylprop-2-enoylamino)methyl]pentanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 69104681 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-[[4-amino-4-methyl-3-[(2-methylprop-2-enoylamino)methyl]pentanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | C=C(C)C(=O)NCC(CC(=O)Nc1ccc(C(=O)O)c(O)c1)C(C)(C)N |
| InChI | InChI=1S/C18H25N3O5/c1-10(2)16(24)20-9-11(18(3,4)19)7-15(23)21-12-5-6-13(17(25)26)14(22)8-12/h5-6,8,11,22H,1,7,9,19H2,2-4H3,(H,20,24)(H,21,23)(H,25,26) |
| InChIKey | YAKVNHQRJUHZTD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|