About 6-bromo-7,8-dihydro-3H-quinolin-2-one
6-bromo-7,8-dihydro-3H-quinolin-2-one (PubChem CID 69104978) has the molecular formula C9H8BrNO
and a molecular weight of 226.07 g/mol. Its IUPAC name is 6-bromo-7,8-dihydro-3H-quinolin-2-one.
Molecular Properties
| Compound Name | 6-bromo-7,8-dihydro-3H-quinolin-2-one |
| PubChem CID | 69104978 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | 6-bromo-7,8-dihydro-3H-quinolin-2-one |
| SMILES | O=C1CC=C2C=C(Br)CCC2=N1 |
| InChI | InChI=1S/C9H8BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1,5H,2-4H2 |
| InChIKey | SMXIICNFRVZIIX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-7,8-dihydro-3H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7,8-dihydro-3H-quinolin-2-one?
The IUPAC name of 6-bromo-7,8-dihydro-3H-quinolin-2-one (CID 69104978) is 6-bromo-7,8-dihydro-3H-quinolin-2-one.
What is the SMILES notation for 6-bromo-7,8-dihydro-3H-quinolin-2-one?
The canonical SMILES for 6-bromo-7,8-dihydro-3H-quinolin-2-one is O=C1CC=C2C=C(Br)CCC2=N1.
What is the InChIKey of 6-bromo-7,8-dihydro-3H-quinolin-2-one?
The InChIKey is SMXIICNFRVZIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO/c10-7-2-3-8-6(5-7)1-4-9(12)11-8/h1,5H,2-4H2.
What are the key properties of 6-bromo-7,8-dihydro-3H-quinolin-2-one?
6-bromo-7,8-dihydro-3H-quinolin-2-one has a molecular weight of 226.07 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7,8-dihydro-3H-quinolin-2-one is sourced from PubChem (CID 69104978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).