C16H14BrNO3 — CID 69106066
(1S,2R,6S,7S)-4-(4-bromo-3-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5,8-trione (PubChem CID 69106066) has the molecular formula C16H14BrNO3 and a molecular weight of 349.19 g/mol. Its IUPAC name is (1S,2R,6S,7S)-4-(4-bromo-3-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5,8-trione.
| Compound Name | (1S,2R,6S,7S)-4-(4-bromo-3-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 69106066 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | (1S,2R,6S,7S)-4-(4-bromo-3-methylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5,8-trione |
| SMILES | Cc1cc(N2C(=O)[C@@H]3[C@@H]([C@@H]4CC(=O)[C@H]3C4)[13C]2=O)ccc1Br |
| InChI | InChI=1S/C16H14BrNO3/c1-7-4-9(2-3-11(7)17)18-15(20)13-8-5-10(12(19)6-8)14(13)16(18)21/h2-4,8,10,13-14H,5-6H2,1H3/t8-,10+,13+,14-/m0/s1/i15+1 |
| InChIKey | JWMAOXGYDQDGCD-OYIPJETBSA-N |
| XLogP | 2.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|