C19H17NO4 — CID 69106255
(1S,6S,7S)-4-(2-methyl-1-benzofuran-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione (PubChem CID 69106255) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is (1S,6S,7S)-4-(2-methyl-1-benzofuran-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione.
| Compound Name | (1S,6S,7S)-4-(2-methyl-1-benzofuran-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
|---|---|
| PubChem CID | 69106255 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (1S,6S,7S)-4-(2-methyl-1-benzofuran-5-yl)-4-azatricyclo[5.2.2.02,6]undecane-3,5,8-trione |
| SMILES | Cc1cc2cc(N3C(=O)C4[C@H]5CC[C@H](C(=O)C5)[C@@H]4C3=O)ccc2o1 |
| InChI | InChI=1S/C19H17NO4/c1-9-6-11-7-12(3-5-15(11)24-9)20-18(22)16-10-2-4-13(14(21)8-10)17(16)19(20)23/h3,5-7,10,13,16-17H,2,4,8H2,1H3/t10-,13+,16?,17-/m0/s1 |
| InChIKey | RNXCTKFGDUWBEC-UWLATUBYSA-N |
| XLogP | 2.85 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|