C23H19NO4 — CID 69106350
(1R,7S)-4-(2-methoxydibenzofuran-3-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 69106350) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (1R,7S)-4-(2-methoxydibenzofuran-3-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,7S)-4-(2-methoxydibenzofuran-3-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 69106350 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (1R,7S)-4-(2-methoxydibenzofuran-3-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | COc1cc2c(cc1N1C(=O)C3C(C1=O)[C@H]1C=C[C@@H]3CC1)oc1ccccc12 |
| InChI | InChI=1S/C23H19NO4/c1-27-19-10-15-14-4-2-3-5-17(14)28-18(15)11-16(19)24-22(25)20-12-6-7-13(9-8-12)21(20)23(24)26/h2-7,10-13,20-21H,8-9H2,1H3/t12-,13+,20?,21? |
| InChIKey | NHZHAYIOAPRSPN-GWEVUABKSA-N |
| XLogP | 4.30 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|