C17H23NO2 — CID 69106450
methyl 3-benzyl-8-methyl-8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 69106450) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is methyl 3-benzyl-8-methyl-8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl 3-benzyl-8-methyl-8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 69106450 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 3-benzyl-8-methyl-8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2)CC2CCC(C1)N2C |
| InChI | InChI=1S/C17H23NO2/c1-18-14-8-9-15(18)12-17(11-14,16(19)20-2)10-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3 |
| InChIKey | QYDFPCBFJCZSNZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |