C19H14ClNO2 — CID 69106490
(1S,2R,7R)-4-(4-chloronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 69106490) has the molecular formula C19H14ClNO2 and a molecular weight of 323.78 g/mol. Its IUPAC name is (1S,2R,7R)-4-(4-chloronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,7R)-4-(4-chloronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 69106490 |
| Molecular Formula | C19H14ClNO2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (1S,2R,7R)-4-(4-chloronaphthalen-1-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2[C@H]3C=C[C@H](C3)[C@H]2C(=O)N1c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H14ClNO2/c20-14-7-8-15(13-4-2-1-3-12(13)14)21-18(22)16-10-5-6-11(9-10)17(16)19(21)23/h1-8,10-11,16-17H,9H2/t10-,11+,16-,17?/m1/s1 |
| InChIKey | VSULRCNBDMEMNW-QOYHLCCESA-N |
| XLogP | 3.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|