C20H23N3O2 — CID 69106540
(1R,2S,6R,7S)-4-[4-(4-methylpiperazin-1-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 69106540) has the molecular formula C20H23N3O2 and a molecular weight of 337.40 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-[4-(4-methylpiperazin-1-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-[4-(4-methylpiperazin-1-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 69106540 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (1R,2S,6R,7S)-4-[4-(4-methylpiperazin-1-yl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)N3C(=O)[C@H]4[C@@H]5C[C@H]([C@H]4C3=O)C=C5 |
| InChI | InChI=1S/C20H23N3O2/c1-21-8-10-22(11-9-21)15-4-6-16(7-5-15)23-19(24)17-13-2-3-14(12-13)18(17)20(23)25/h2-7,13-14,17-18H,8-12H2,1H3/t13-,14+,17-,18+ |
| InChIKey | BLTMCFHIZZHHNB-MHGIMSBQSA-N |
| XLogP | 1.80 |
| TPSA | 43.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | 572 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|