About 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine
3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine (PubChem CID 69106663) has the molecular formula C13H13F2N3
and a molecular weight of 249.26 g/mol. Its IUPAC name is 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine |
| PubChem CID | 69106663 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine |
| SMILES | NCCCc1ccc(-c2ccc(F)c(F)c2)nn1 |
| InChI | InChI=1S/C13H13F2N3/c14-11-5-3-9(8-12(11)15)13-6-4-10(17-18-13)2-1-7-16/h3-6,8H,1-2,7,16H2 |
| InChIKey | KWYCNWURJSITGL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine?
The IUPAC name of 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine (CID 69106663) is 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine.
What is the SMILES notation for 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine?
The canonical SMILES for 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine is NCCCc1ccc(-c2ccc(F)c(F)c2)nn1.
What is the InChIKey of 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine?
The InChIKey is KWYCNWURJSITGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3/c14-11-5-3-9(8-12(11)15)13-6-4-10(17-18-13)2-1-7-16/h3-6,8H,1-2,7,16H2.
What are the key properties of 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine?
3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine has a molecular weight of 249.26 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(3,4-difluorophenyl)pyridazin-3-yl]propan-1-amine is sourced from PubChem (CID 69106663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).