C7H14N2O4S — CID 69106665
2-[methyl(methylsulfonyl)amino]pyrrolidine-1-carboxylic acid (PubChem CID 69106665) has the molecular formula C7H14N2O4S and a molecular weight of 222.27 g/mol. Its IUPAC name is 2-[methyl(methylsulfonyl)amino]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[methyl(methylsulfonyl)amino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69106665 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-[methyl(methylsulfonyl)amino]pyrrolidine-1-carboxylic acid |
| SMILES | CN(C1CCCN1C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C7H14N2O4S/c1-8(14(2,12)13)6-4-3-5-9(6)7(10)11/h6H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | ZSWNXLZYASVDFI-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |