C19H27ClO3 — CID 69106948
(8S,9R,10S,13R,14S)-16-chloro-3-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthrene-1,7-dione (PubChem CID 69106948) has the molecular formula C19H27ClO3 and a molecular weight of 338.88 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-16-chloro-3-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthrene-1,7-dione.
| Compound Name | (8S,9R,10S,13R,14S)-16-chloro-3-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthrene-1,7-dione |
|---|---|
| PubChem CID | 69106948 |
| Molecular Formula | C19H27ClO3 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (8S,9R,10S,13R,14S)-16-chloro-3-hydroxy-10,13-dimethyl-3,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-2H-cyclopenta[a]phenanthrene-1,7-dione |
| SMILES | C[C@]12CC[C@@H]3[C@@H](C(=O)CC4CC(O)CC(=O)[C@@]43C)[C@@H]1CC(Cl)C2 |
| InChI | InChI=1S/C19H27ClO3/c1-18-4-3-13-17(14(18)7-11(20)9-18)15(22)6-10-5-12(21)8-16(23)19(10,13)2/h10-14,17,21H,3-9H2,1-2H3/t10?,11?,12?,13-,14+,17-,18-,19+/m1/s1 |
| InChIKey | FWBOKVFWGJRZIM-BLRSTOKBSA-N |
| XLogP | 3.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|