About 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile
6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile (PubChem CID 69107043) has the molecular formula C12H10F3N3O
and a molecular weight of 269.23 g/mol. Its IUPAC name is 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile |
| PubChem CID | 69107043 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile |
| SMILES | Cc1cn(C2(OC(F)(F)F)C=CC=CC2C#N)cn1 |
| InChI | InChI=1S/C12H10F3N3O/c1-9-7-18(8-17-9)11(19-12(13,14)15)5-3-2-4-10(11)6-16/h2-5,7-8,10H,1H3 |
| InChIKey | STFVYVULGLBSPM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile?
The IUPAC name of 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile (CID 69107043) is 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile.
What is the SMILES notation for 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile?
The canonical SMILES for 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile is Cc1cn(C2(OC(F)(F)F)C=CC=CC2C#N)cn1.
What is the InChIKey of 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile?
The InChIKey is STFVYVULGLBSPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F3N3O/c1-9-7-18(8-17-9)11(19-12(13,14)15)5-3-2-4-10(11)6-16/h2-5,7-8,10H,1H3.
What are the key properties of 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile?
6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile has a molecular weight of 269.23 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methylimidazol-1-yl)-6-(trifluoromethoxy)cyclohexa-2,4-diene-1-carbonitrile is sourced from PubChem (CID 69107043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).