C42H55F2N5O6S — CID 69107504
ethyl 2,5-bis[(3,5-diethoxy-4-fluorophenyl)methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 69107504) has the molecular formula C42H55F2N5O6S and a molecular weight of 795.99 g/mol. Its IUPAC name is ethyl 2,5-bis[(3,5-diethoxy-4-fluorophenyl)methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2,5-bis[(3,5-diethoxy-4-fluorophenyl)methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 69107504 |
| Molecular Formula | C42H55F2N5O6S |
| Molecular Weight | 795.99 g/mol |
| Exact Mass | 795.38 |
| IUPAC Name | ethyl 2,5-bis[(3,5-diethoxy-4-fluorophenyl)methyl-piperidin-4-ylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc2sc(N(Cc3cc(OCC)c(F)c(OCC)c3)C3CCNCC3)nc2cc1N(Cc1cc(OCC)c(F)c(OCC)c1)C1CCNCC1 |
| InChI | InChI=1S/C42H55F2N5O6S/c1-6-51-34-19-27(20-35(39(34)43)52-7-2)25-48(29-11-15-45-16-12-29)33-24-32-38(23-31(33)41(50)55-10-5)56-42(47-32)49(30-13-17-46-18-14-30)26-28-21-36(53-8-3)40(44)37(22-28)54-9-4/h19-24,29-30,45-46H,6-18,25-26H2,1-5H3 |
| InChIKey | UWHBZPHGWLWOFQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 106.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.99 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |