C10H18N2O5 — CID 69107668
(4S)-4-[2-(methoxymethylamino)-2-oxoethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 69107668) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is (4S)-4-[2-(methoxymethylamino)-2-oxoethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
| Compound Name | (4S)-4-[2-(methoxymethylamino)-2-oxoethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69107668 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (4S)-4-[2-(methoxymethylamino)-2-oxoethyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | COCNC(=O)C[C@H]1COC(C)(C)N1C(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-10(2)12(9(14)15)7(5-17-10)4-8(13)11-6-16-3/h7H,4-6H2,1-3H3,(H,11,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | PAVYWQIJXFRFTG-ZETCQYMHSA-N |
| XLogP | 0.21 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|