About 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran
7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran (PubChem CID 69107909) has the molecular formula C23H20Cl2O
and a molecular weight of 383.32 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 69107909 |
| Molecular Formula | C23H20Cl2O |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc2c(c(-c3c(Cl)cccc3Cl)c1)OC(CCc1ccccc1)C2 |
| InChI | InChI=1S/C23H20Cl2O/c1-15-12-17-14-18(11-10-16-6-3-2-4-7-16)26-23(17)19(13-15)22-20(24)8-5-9-21(22)25/h2-9,12-13,18H,10-11,14H2,1H3 |
| InChIKey | BEWWAMUJKRXLCK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran (CID 69107909) is 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran is Cc1cc2c(c(-c3c(Cl)cccc3Cl)c1)OC(CCc1ccccc1)C2.
What is the InChIKey of 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran?
The InChIKey is BEWWAMUJKRXLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20Cl2O/c1-15-12-17-14-18(11-10-16-6-3-2-4-7-16)26-23(17)19(13-15)22-20(24)8-5-9-21(22)25/h2-9,12-13,18H,10-11,14H2,1H3.
What are the key properties of 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran?
7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran has a molecular weight of 383.32 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,6-dichlorophenyl)-5-methyl-2-(2-phenylethyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 69107909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).