About 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran
7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 69107948) has the molecular formula C16H14Cl2O2
and a molecular weight of 309.19 g/mol. Its IUPAC name is 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran |
| PubChem CID | 69107948 |
| Molecular Formula | C16H14Cl2O2 |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | COc1cc2c(c(-c3cc(Cl)ccc3Cl)c1)OC(C)C2 |
| InChI | InChI=1S/C16H14Cl2O2/c1-9-5-10-6-12(19-2)8-14(16(10)20-9)13-7-11(17)3-4-15(13)18/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | BXMBSSSWLYINDG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran?
The IUPAC name of 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran (CID 69107948) is 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran?
The canonical SMILES for 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran is COc1cc2c(c(-c3cc(Cl)ccc3Cl)c1)OC(C)C2.
What is the InChIKey of 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran?
The InChIKey is BXMBSSSWLYINDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O2/c1-9-5-10-6-12(19-2)8-14(16(10)20-9)13-7-11(17)3-4-15(13)18/h3-4,6-9H,5H2,1-2H3.
What are the key properties of 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran?
7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran has a molecular weight of 309.19 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,5-dichlorophenyl)-5-methoxy-2-methyl-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 69107948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).