C18H19NO5 — CID 69108460
1-[(3,4,5-trimethoxyphenyl)methyl]-7,7a-dihydroindole-2,3-dione (PubChem CID 69108460) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 1-[(3,4,5-trimethoxyphenyl)methyl]-7,7a-dihydroindole-2,3-dione.
| Compound Name | 1-[(3,4,5-trimethoxyphenyl)methyl]-7,7a-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 69108460 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1-[(3,4,5-trimethoxyphenyl)methyl]-7,7a-dihydroindole-2,3-dione |
| SMILES | COc1cc(CN2C(=O)C(=O)C3=CC=CCC32)cc(OC)c1OC |
| InChI | InChI=1S/C18H19NO5/c1-22-14-8-11(9-15(23-2)17(14)24-3)10-19-13-7-5-4-6-12(13)16(20)18(19)21/h4-6,8-9,13H,7,10H2,1-3H3 |
| InChIKey | BSLCJLDBGVZWGN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|