About 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one
3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one (PubChem CID 69108773) has the molecular formula C20H20BrNO4
and a molecular weight of 418.29 g/mol. Its IUPAC name is 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one.
Molecular Properties
| Compound Name | 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one |
| PubChem CID | 69108773 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one |
| SMILES | CCCCCN1C(=O)C(Br)(c2cc3c(cc2O)OCO3)c2ccccc21 |
| InChI | InChI=1S/C20H20BrNO4/c1-2-3-6-9-22-15-8-5-4-7-13(15)20(21,19(22)24)14-10-17-18(11-16(14)23)26-12-25-17/h4-5,7-8,10-11,23H,2-3,6,9,12H2,1H3 |
| InChIKey | ZWPJVLRKGHMMMB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one?
The IUPAC name of 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one (CID 69108773) is 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one.
What is the SMILES notation for 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one?
The canonical SMILES for 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one is CCCCCN1C(=O)C(Br)(c2cc3c(cc2O)OCO3)c2ccccc21.
What is the InChIKey of 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one?
The InChIKey is ZWPJVLRKGHMMMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20BrNO4/c1-2-3-6-9-22-15-8-5-4-7-13(15)20(21,19(22)24)14-10-17-18(11-16(14)23)26-12-25-17/h4-5,7-8,10-11,23H,2-3,6,9,12H2,1H3.
What are the key properties of 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one?
3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one has a molecular weight of 418.29 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-3-(6-hydroxy-1,3-benzodioxol-5-yl)-1-pentylindol-2-one is sourced from PubChem (CID 69108773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).