C10H13NO — CID 69108967
5,6,7,8-tetrahydroquinolin-6-ylmethanol (PubChem CID 69108967) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-6-ylmethanol.
| Compound Name | 5,6,7,8-tetrahydroquinolin-6-ylmethanol |
|---|---|
| PubChem CID | 69108967 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-6-ylmethanol |
| SMILES | OCC1CCc2ncccc2C1 |
| InChI | InChI=1S/C10H13NO/c12-7-8-3-4-10-9(6-8)2-1-5-11-10/h1-2,5,8,12H,3-4,6-7H2 |
| InChIKey | QJPKUEWDNWXQJL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |