C12H12F3NO2 — CID 69108980
1-(4,4,4-trifluorobutyl)-7,7a-dihydroindole-2,3-dione (PubChem CID 69108980) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutyl)-7,7a-dihydroindole-2,3-dione.
| Compound Name | 1-(4,4,4-trifluorobutyl)-7,7a-dihydroindole-2,3-dione |
|---|---|
| PubChem CID | 69108980 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(4,4,4-trifluorobutyl)-7,7a-dihydroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCC(F)(F)F)C2CC=CC=C12 |
| InChI | InChI=1S/C12H12F3NO2/c13-12(14,15)6-3-7-16-9-5-2-1-4-8(9)10(17)11(16)18/h1-2,4,9H,3,5-7H2 |
| InChIKey | FHTYSKDJQRGOQY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|