C19H21FN4O2 — CID 69109071
[3-[3-(4-fluorophenyl)-2H-oxadiazol-5-yl]piperidin-1-yl]-(1-methylpyrrol-2-yl)methanone (PubChem CID 69109071) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is [3-[3-(4-fluorophenyl)-2H-oxadiazol-5-yl]piperidin-1-yl]-(1-methylpyrrol-2-yl)methanone.
| Compound Name | [3-[3-(4-fluorophenyl)-2H-oxadiazol-5-yl]piperidin-1-yl]-(1-methylpyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 69109071 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [3-[3-(4-fluorophenyl)-2H-oxadiazol-5-yl]piperidin-1-yl]-(1-methylpyrrol-2-yl)methanone |
| SMILES | Cn1cccc1C(=O)N1CCCC(C2=CN(c3ccc(F)cc3)NO2)C1 |
| InChI | InChI=1S/C19H21FN4O2/c1-22-10-3-5-17(22)19(25)23-11-2-4-14(12-23)18-13-24(21-26-18)16-8-6-15(20)7-9-16/h3,5-10,13-14,21H,2,4,11-12H2,1H3 |
| InChIKey | FRUJAQAKQAGWMH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |