About 1-fluorobutyl benzotriazole-1-carboxylate
1-fluorobutyl benzotriazole-1-carboxylate (PubChem CID 69109144) has the molecular formula C11H12FN3O2
and a molecular weight of 237.23 g/mol. Its IUPAC name is 1-fluorobutyl benzotriazole-1-carboxylate.
Molecular Properties
| Compound Name | 1-fluorobutyl benzotriazole-1-carboxylate |
| PubChem CID | 69109144 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-fluorobutyl benzotriazole-1-carboxylate |
| SMILES | CCCC(F)OC(=O)n1nnc2ccccc21 |
| InChI | InChI=1S/C11H12FN3O2/c1-2-5-10(12)17-11(16)15-9-7-4-3-6-8(9)13-14-15/h3-4,6-7,10H,2,5H2,1H3 |
| InChIKey | MMJUFMUANQXUSK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-fluorobutyl benzotriazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorobutyl benzotriazole-1-carboxylate?
The IUPAC name of 1-fluorobutyl benzotriazole-1-carboxylate (CID 69109144) is 1-fluorobutyl benzotriazole-1-carboxylate.
What is the SMILES notation for 1-fluorobutyl benzotriazole-1-carboxylate?
The canonical SMILES for 1-fluorobutyl benzotriazole-1-carboxylate is CCCC(F)OC(=O)n1nnc2ccccc21.
What is the InChIKey of 1-fluorobutyl benzotriazole-1-carboxylate?
The InChIKey is MMJUFMUANQXUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN3O2/c1-2-5-10(12)17-11(16)15-9-7-4-3-6-8(9)13-14-15/h3-4,6-7,10H,2,5H2,1H3.
What are the key properties of 1-fluorobutyl benzotriazole-1-carboxylate?
1-fluorobutyl benzotriazole-1-carboxylate has a molecular weight of 237.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutyl benzotriazole-1-carboxylate is sourced from PubChem (CID 69109144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).