About 1H-1,3-diazepine-5-carboxamide
1H-1,3-diazepine-5-carboxamide (PubChem CID 69109435) has the molecular formula C6H7N3O
and a molecular weight of 137.14 g/mol. Its IUPAC name is 1H-1,3-diazepine-5-carboxamide.
Molecular Properties
| Compound Name | 1H-1,3-diazepine-5-carboxamide |
| PubChem CID | 69109435 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 1H-1,3-diazepine-5-carboxamide |
| SMILES | NC(=O)C1=CN=CNC=C1 |
| InChI | InChI=1S/C6H7N3O/c7-6(10)5-1-2-8-4-9-3-5/h1-4H,(H2,7,10)(H,8,9) |
| InChIKey | QCVMJBIGQOCOGZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-1,3-diazepine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1,3-diazepine-5-carboxamide?
The IUPAC name of 1H-1,3-diazepine-5-carboxamide (CID 69109435) is 1H-1,3-diazepine-5-carboxamide.
What is the SMILES notation for 1H-1,3-diazepine-5-carboxamide?
The canonical SMILES for 1H-1,3-diazepine-5-carboxamide is NC(=O)C1=CN=CNC=C1.
What is the InChIKey of 1H-1,3-diazepine-5-carboxamide?
The InChIKey is QCVMJBIGQOCOGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O/c7-6(10)5-1-2-8-4-9-3-5/h1-4H,(H2,7,10)(H,8,9).
What are the key properties of 1H-1,3-diazepine-5-carboxamide?
1H-1,3-diazepine-5-carboxamide has a molecular weight of 137.14 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1,3-diazepine-5-carboxamide is sourced from PubChem (CID 69109435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).