About Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt
Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt (PubChem CID 69109805) has the molecular formula C19H20LiO4
and a molecular weight of 319.31 g/mol.
Molecular Properties
| Compound Name | Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt |
| PubChem CID | 69109805 |
| Molecular Formula | C19H20LiO4 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(C)C(=O)c1ccc(OCc2ccccc2)cc1.[Li] |
| InChI | InChI=1S/C19H20O4.Li/c1-3-22-19(21)14(2)18(20)16-9-11-17(12-10-16)23-13-15-7-5-4-6-8-15;/h4-12,14H,3,13H2,1-2H3; |
| InChIKey | VODFBNMRACCHAC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt?
The IUPAC name of Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt (CID 69109805) is not available.
What is the SMILES notation for Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt?
The canonical SMILES for Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt is CCOC(=O)C(C)C(=O)c1ccc(OCc2ccccc2)cc1.[Li].
What is the InChIKey of Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt?
The InChIKey is VODFBNMRACCHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4.Li/c1-3-22-19(21)14(2)18(20)16-9-11-17(12-10-16)23-13-15-7-5-4-6-8-15;/h4-12,14H,3,13H2,1-2H3;.
What are the key properties of Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt?
Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt has a molecular weight of 319.31 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 3-[4-(benzyloxy)phenyl]-2-methyl-3-oxopropanoate lithium salt is sourced from PubChem (CID 69109805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).