About 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide
2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide (PubChem CID 69110936) has the molecular formula C19H29N3O2
and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide.
Molecular Properties
| Compound Name | 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide |
| PubChem CID | 69110936 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(C2CCN(C(=O)[C@@H](N)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H29N3O2/c1-12-5-6-14(17(21)23)15(11-12)13-7-9-22(10-8-13)18(24)16(20)19(2,3)4/h5-6,11,13,16H,7-10,20H2,1-4H3,(H2,21,23)/t16-/m1/s1 |
| InChIKey | FQICLVVZZCWONF-MRXNPFEDSA-N |
| XLogP | 2.17 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide?
The IUPAC name of 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide (CID 69110936) is 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide.
What is the SMILES notation for 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide?
The canonical SMILES for 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide is Cc1ccc(C(N)=O)c(C2CCN(C(=O)[C@@H](N)C(C)(C)C)CC2)c1.
What is the InChIKey of 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide?
The InChIKey is FQICLVVZZCWONF-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H29N3O2/c1-12-5-6-14(17(21)23)15(11-12)13-7-9-22(10-8-13)18(24)16(20)19(2,3)4/h5-6,11,13,16H,7-10,20H2,1-4H3,(H2,21,23)/t16-/m1/s1.
What are the key properties of 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide?
2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide has a molecular weight of 331.46 g/mol, XLogP of 2.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2S)-2-amino-3,3-dimethylbutanoyl]piperidin-4-yl]-4-methylbenzamide is sourced from PubChem (CID 69110936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).