About azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene
azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 69111182) has the molecular formula C8H11N
and a molecular weight of 121.18 g/mol. Its IUPAC name is azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene.
Molecular Properties
| Compound Name | azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene |
| PubChem CID | 69111182 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | Cc1c2ccc-2c1C.N |
| InChI | InChI=1S/C8H8.H3N/c1-5-6(2)8-4-3-7(5)8;/h3-4H,1-2H3;1H3 |
| InChIKey | VWNWOHTZFABWRI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene?
The IUPAC name of azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene (CID 69111182) is azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene.
What is the SMILES notation for azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene?
The canonical SMILES for azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene is Cc1c2ccc-2c1C.N.
What is the InChIKey of azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene?
The InChIKey is VWNWOHTZFABWRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.H3N/c1-5-6(2)8-4-3-7(5)8;/h3-4H,1-2H3;1H3.
What are the key properties of azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene?
azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene has a molecular weight of 121.18 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,3-dimethylbicyclo[2.2.0]hexa-1,3,5-triene is sourced from PubChem (CID 69111182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).