C18H21BrN4O — CID 69111946
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(1-bromocyclopropyl)-1H-indazole-3-carboxamide (PubChem CID 69111946) has the molecular formula C18H21BrN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(1-bromocyclopropyl)-1H-indazole-3-carboxamide.
| Compound Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(1-bromocyclopropyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 69111946 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-6-(1-bromocyclopropyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CN2CCC1CC2)c1n[nH]c2cc(C3(Br)CC3)ccc12 |
| InChI | InChI=1S/C18H21BrN4O/c19-18(5-6-18)12-1-2-13-14(9-12)21-22-16(13)17(24)20-15-10-23-7-3-11(15)4-8-23/h1-2,9,11,15H,3-8,10H2,(H,20,24)(H,21,22)/t15-/m1/s1 |
| InChIKey | AUZCMAODEBKMJI-OAHLLOKOSA-N |
| XLogP | 2.77 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|