C24H35N9O2 — CID 69112138
2-N-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)pyrimidine-2,5-dicarboxamide (PubChem CID 69112138) has the molecular formula C24H35N9O2 and a molecular weight of 481.61 g/mol. Its IUPAC name is 2-N-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)pyrimidine-2,5-dicarboxamide.
| Compound Name | 2-N-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)pyrimidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 69112138 |
| Molecular Formula | C24H35N9O2 |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 2-N-[4-[di(propan-2-yl)amino]butyl]-5-N,5-N-bis(1H-imidazol-2-ylmethyl)pyrimidine-2,5-dicarboxamide |
| SMILES | CC(C)N(CCCCNC(=O)c1ncc(C(=O)N(Cc2ncc[nH]2)Cc2ncc[nH]2)cn1)C(C)C |
| InChI | InChI=1S/C24H35N9O2/c1-17(2)33(18(3)4)12-6-5-7-29-23(34)22-30-13-19(14-31-22)24(35)32(15-20-25-8-9-26-20)16-21-27-10-11-28-21/h8-11,13-14,17-18H,5-7,12,15-16H2,1-4H3,(H,25,26)(H,27,28)(H,29,34) |
| InChIKey | CIHCCWRXBTULSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|