About [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine
[7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine (PubChem CID 69112690) has the molecular formula C15H13Cl2NO
and a molecular weight of 294.18 g/mol. Its IUPAC name is [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine |
| PubChem CID | 69112690 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine |
| SMILES | NCC1Cc2cccc(-c3cccc(Cl)c3Cl)c2O1 |
| InChI | InChI=1S/C15H13Cl2NO/c16-13-6-2-4-11(14(13)17)12-5-1-3-9-7-10(8-18)19-15(9)12/h1-6,10H,7-8,18H2 |
| InChIKey | HXQFKRJXDJMXEY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The IUPAC name of [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine (CID 69112690) is [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine.
What is the SMILES notation for [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The canonical SMILES for [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine is NCC1Cc2cccc(-c3cccc(Cl)c3Cl)c2O1.
What is the InChIKey of [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine?
The InChIKey is HXQFKRJXDJMXEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO/c16-13-6-2-4-11(14(13)17)12-5-1-3-9-7-10(8-18)19-15(9)12/h1-6,10H,7-8,18H2.
What are the key properties of [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine?
[7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine has a molecular weight of 294.18 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(2,3-dichlorophenyl)-2,3-dihydro-1-benzofuran-2-yl]methanamine is sourced from PubChem (CID 69112690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).